C22H28N2S — CID 162665117
2-[2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]-N-methylethanamine (PubChem CID 162665117) has the molecular formula C22H28N2S and a molecular weight of 352.55 g/mol. Its IUPAC name is 2-[2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]-N-methylethanamine.
| Compound Name | 2-[2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 162665117 |
| Molecular Formula | C22H28N2S |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-[2-[4-(1-adamantyl)phenyl]-1,3-thiazol-4-yl]-N-methylethanamine |
| SMILES | CNCCc1csc(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)n1 |
| InChI | InChI=1S/C22H28N2S/c1-23-7-6-20-14-25-21(24-20)18-2-4-19(5-3-18)22-11-15-8-16(12-22)10-17(9-15)13-22/h2-5,14-17,23H,6-13H2,1H3 |
| InChIKey | KAFFAOBFSHWWAA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |