C9H11F3N4O2 — CID 162665423
2-(5-methyl-2-pyridinyl)guanidine;2,2,2-trifluoroacetic acid (PubChem CID 162665423) has the molecular formula C9H11F3N4O2 and a molecular weight of 264.21 g/mol. Its IUPAC name is 2-(5-methyl-2-pyridinyl)guanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(5-methyl-2-pyridinyl)guanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162665423 |
| Molecular Formula | C9H11F3N4O2 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-(5-methyl-2-pyridinyl)guanidine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(N=C(N)N)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H10N4.C2HF3O2/c1-5-2-3-6(10-4-5)11-7(8)9;3-2(4,5)1(6)7/h2-4H,1H3,(H4,8,9,10,11);(H,6,7) |
| InChIKey | PQCWIEDIIGGKBZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|