C21H23ClN4O3 — CID 162667220
N-[6-(4-chlorophenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide (PubChem CID 162667220) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[6-(4-chlorophenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide.
| Compound Name | N-[6-(4-chlorophenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 162667220 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[6-(4-chlorophenyl)-1H-indazol-3-yl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1n[nH]c2cc(-c3ccc(Cl)cc3)ccc12)NO |
| InChI | InChI=1S/C21H23ClN4O3/c22-16-10-7-14(8-11-16)15-9-12-17-18(13-15)24-25-21(17)23-19(27)5-3-1-2-4-6-20(28)26-29/h7-13,29H,1-6H2,(H,26,28)(H2,23,24,25,27) |
| InChIKey | FFSKTCXMDQFURH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|