C17H14ClN3O3 — CID 69060604
[2-[[6-(3-chlorophenyl)-1H-indazol-3-yl]amino]-2-oxoethyl] acetate (PubChem CID 69060604) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is [2-[[6-(3-chlorophenyl)-1H-indazol-3-yl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[6-(3-chlorophenyl)-1H-indazol-3-yl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 69060604 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [2-[[6-(3-chlorophenyl)-1H-indazol-3-yl]amino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)Nc1n[nH]c2cc(-c3cccc(Cl)c3)ccc12 |
| InChI | InChI=1S/C17H14ClN3O3/c1-10(22)24-9-16(23)19-17-14-6-5-12(8-15(14)20-21-17)11-3-2-4-13(18)7-11/h2-8H,9H2,1H3,(H2,19,20,21,23) |
| InChIKey | PWACMAUYXVSPBT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |