C26H23N7O5S — CID 162668343
N-[2-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)phenoxy]ethyl]-4-sulfamoylbenzamide (PubChem CID 162668343) has the molecular formula C26H23N7O5S and a molecular weight of 545.58 g/mol. Its IUPAC name is N-[2-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)phenoxy]ethyl]-4-sulfamoylbenzamide.
| Compound Name | N-[2-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)phenoxy]ethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 162668343 |
| Molecular Formula | C26H23N7O5S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | N-[2-[4-(8-amino-3-oxo-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-6-yl)phenoxy]ethyl]-4-sulfamoylbenzamide |
| SMILES | Nc1nc(-c2ccc(OCCNC(=O)c3ccc(S(N)(=O)=O)cc3)cc2)cn2c(=O)n(-c3ccccc3)nc12 |
| InChI | InChI=1S/C26H23N7O5S/c27-23-24-31-33(19-4-2-1-3-5-19)26(35)32(24)16-22(30-23)17-6-10-20(11-7-17)38-15-14-29-25(34)18-8-12-21(13-9-18)39(28,36)37/h1-13,16H,14-15H2,(H2,27,30)(H,29,34)(H2,28,36,37) |
| InChIKey | MNEFMHDHCVMLFV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 176.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|