C24H21ClN4O2 — CID 44763130
4-[5-amino-3-(4-chlorophenyl)pyrazol-1-yl]-N-(2-phenoxyethyl)benzamide (PubChem CID 44763130) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 4-[5-amino-3-(4-chlorophenyl)pyrazol-1-yl]-N-(2-phenoxyethyl)benzamide.
| Compound Name | 4-[5-amino-3-(4-chlorophenyl)pyrazol-1-yl]-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 44763130 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-[5-amino-3-(4-chlorophenyl)pyrazol-1-yl]-N-(2-phenoxyethyl)benzamide |
| SMILES | Nc1cc(-c2ccc(Cl)cc2)nn1-c1ccc(C(=O)NCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21ClN4O2/c25-19-10-6-17(7-11-19)22-16-23(26)29(28-22)20-12-8-18(9-13-20)24(30)27-14-15-31-21-4-2-1-3-5-21/h1-13,16H,14-15,26H2,(H,27,30) |
| InChIKey | USEGMABADDZOGW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|