About 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea
1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea (PubChem CID 42685093) has the molecular formula C24H21Cl2N5O2
and a molecular weight of 482.37 g/mol. Its IUPAC name is 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea.
Molecular Properties
| Compound Name | 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea |
| PubChem CID | 42685093 |
| Molecular Formula | C24H21Cl2N5O2 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea |
| SMILES | Nc1c(NC(=O)NCCOc2ccccc2)c(-c2ccc(Cl)cc2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21Cl2N5O2/c25-17-8-6-16(7-9-17)21-22(23(27)31(30-21)19-12-10-18(26)11-13-19)29-24(32)28-14-15-33-20-4-2-1-3-5-20/h1-13H,14-15,27H2,(H2,28,29,32) |
| InChIKey | ALQPPLRPUQEWHD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea?
The IUPAC name of 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea (CID 42685093) is 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea.
What is the SMILES notation for 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea?
The canonical SMILES for 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea is Nc1c(NC(=O)NCCOc2ccccc2)c(-c2ccc(Cl)cc2)nn1-c1ccc(Cl)cc1.
What is the InChIKey of 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea?
The InChIKey is ALQPPLRPUQEWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Cl2N5O2/c25-17-8-6-16(7-9-17)21-22(23(27)31(30-21)19-12-10-18(26)11-13-19)29-24(32)28-14-15-33-20-4-2-1-3-5-20/h1-13H,14-15,27H2,(H2,28,29,32).
What are the key properties of 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea?
1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea has a molecular weight of 482.37 g/mol, XLogP of 5.63, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-amino-1,3-bis(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea is sourced from PubChem (CID 42685093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).