C24H22ClN5O — CID 42685189
3-[5-amino-3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-1-benzyl-1-methylurea (PubChem CID 42685189) has the molecular formula C24H22ClN5O and a molecular weight of 431.93 g/mol. Its IUPAC name is 3-[5-amino-3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-1-benzyl-1-methylurea.
| Compound Name | 3-[5-amino-3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-1-benzyl-1-methylurea |
|---|---|
| PubChem CID | 42685189 |
| Molecular Formula | C24H22ClN5O |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[5-amino-3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-1-benzyl-1-methylurea |
| SMILES | CN(Cc1ccccc1)C(=O)Nc1c(-c2ccc(Cl)cc2)nn(-c2ccccc2)c1N |
| InChI | InChI=1S/C24H22ClN5O/c1-29(16-17-8-4-2-5-9-17)24(31)27-22-21(18-12-14-19(25)15-13-18)28-30(23(22)26)20-10-6-3-7-11-20/h2-15H,16,26H2,1H3,(H,27,31) |
| InChIKey | QXITZPAJVPTWEX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |