C25H24ClN5O2 — CID 42685078
1-[5-amino-1-benzyl-3-(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea (PubChem CID 42685078) has the molecular formula C25H24ClN5O2 and a molecular weight of 461.95 g/mol. Its IUPAC name is 1-[5-amino-1-benzyl-3-(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea.
| Compound Name | 1-[5-amino-1-benzyl-3-(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea |
|---|---|
| PubChem CID | 42685078 |
| Molecular Formula | C25H24ClN5O2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-[5-amino-1-benzyl-3-(4-chlorophenyl)pyrazol-4-yl]-3-(2-phenoxyethyl)urea |
| SMILES | Nc1c(NC(=O)NCCOc2ccccc2)c(-c2ccc(Cl)cc2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C25H24ClN5O2/c26-20-13-11-19(12-14-20)22-23(24(27)31(30-22)17-18-7-3-1-4-8-18)29-25(32)28-15-16-33-21-9-5-2-6-10-21/h1-14H,15-17,27H2,(H2,28,29,32) |
| InChIKey | GIFMCRFKNMSWIP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|