C21H23ClN4O2 — CID 86902399
1-[2-(4-chlorophenoxy)ethyl]-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]urea (PubChem CID 86902399) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 86902399 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]urea |
| SMILES | Cc1cc(C)n(Cc2cccc(NC(=O)NCCOc3ccc(Cl)cc3)c2)n1 |
| InChI | InChI=1S/C21H23ClN4O2/c1-15-12-16(2)26(25-15)14-17-4-3-5-19(13-17)24-21(27)23-10-11-28-20-8-6-18(22)7-9-20/h3-9,12-13H,10-11,14H2,1-2H3,(H2,23,24,27) |
| InChIKey | DXAYPTDPJBCOJD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|