C20H22Cl2N6O — CID 86902415
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]urea (PubChem CID 86902415) has the molecular formula C20H22Cl2N6O and a molecular weight of 433.34 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]urea.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 86902415 |
| Molecular Formula | C20H22Cl2N6O |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]urea |
| SMILES | Cc1cc(C)n(Cc2cccc(NC(=O)NCCNc3ncc(Cl)cc3Cl)c2)n1 |
| InChI | InChI=1S/C20H22Cl2N6O/c1-13-8-14(2)28(27-13)12-15-4-3-5-17(9-15)26-20(29)24-7-6-23-19-18(22)10-16(21)11-25-19/h3-5,8-11H,6-7,12H2,1-2H3,(H,23,25)(H2,24,26,29) |
| InChIKey | UJAMCZJYDKIJKH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|