C22H22N4O — CID 162670405
5-(1-methylpyrazol-4-yl)-3-(3-piperidin-4-ylphenyl)furo[3,2-b]pyridine (PubChem CID 162670405) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 5-(1-methylpyrazol-4-yl)-3-(3-piperidin-4-ylphenyl)furo[3,2-b]pyridine.
| Compound Name | 5-(1-methylpyrazol-4-yl)-3-(3-piperidin-4-ylphenyl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 162670405 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 5-(1-methylpyrazol-4-yl)-3-(3-piperidin-4-ylphenyl)furo[3,2-b]pyridine |
| SMILES | Cn1cc(-c2ccc3occ(-c4cccc(C5CCNCC5)c4)c3n2)cn1 |
| InChI | InChI=1S/C22H22N4O/c1-26-13-18(12-24-26)20-5-6-21-22(25-20)19(14-27-21)17-4-2-3-16(11-17)15-7-9-23-10-8-15/h2-6,11-15,23H,7-10H2,1H3 |
| InChIKey | YEFYCSKFDBXSSK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |