C22H34N2O3 — CID 162670595
[4-(4-tert-butylcyclohexyl)piperazin-1-yl]-(4-hydroxy-3-methoxyphenyl)methanone (PubChem CID 162670595) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is [4-(4-tert-butylcyclohexyl)piperazin-1-yl]-(4-hydroxy-3-methoxyphenyl)methanone.
| Compound Name | [4-(4-tert-butylcyclohexyl)piperazin-1-yl]-(4-hydroxy-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 162670595 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | [4-(4-tert-butylcyclohexyl)piperazin-1-yl]-(4-hydroxy-3-methoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCN(C3CCC(C(C)(C)C)CC3)CC2)ccc1O |
| InChI | InChI=1S/C22H34N2O3/c1-22(2,3)17-6-8-18(9-7-17)23-11-13-24(14-12-23)21(26)16-5-10-19(25)20(15-16)27-4/h5,10,15,17-18,25H,6-9,11-14H2,1-4H3 |
| InChIKey | AQKVUGBGWJWVFO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |