C19H30N6O2 — CID 123698522
2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidine-1-carbonyl]phenyl]guanidine (PubChem CID 123698522) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidine-1-carbonyl]phenyl]guanidine.
| Compound Name | 2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidine-1-carbonyl]phenyl]guanidine |
|---|---|
| PubChem CID | 123698522 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidine-1-carbonyl]phenyl]guanidine |
| SMILES | COc1cc(C(=O)N2CCC(N3CCN(C)CC3)CC2)ccc1N=C(N)N |
| InChI | InChI=1S/C19H30N6O2/c1-23-9-11-24(12-10-23)15-5-7-25(8-6-15)18(26)14-3-4-16(22-19(20)21)17(13-14)27-2/h3-4,13,15H,5-12H2,1-2H3,(H4,20,21,22) |
| InChIKey | BJWGOINTOWSECE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|