C17H14N4O2S — CID 162670809
N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine (PubChem CID 162670809) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine.
| Compound Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine |
|---|---|
| PubChem CID | 162670809 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-amine |
| SMILES | c1cnc2c(c1)CCC/C2=N\Nc1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C17H14N4O2S/c1-3-10-4-2-6-18-16(10)11(5-1)20-21-17-19-12-7-13-14(23-9-22-13)8-15(12)24-17/h2,4,6-8H,1,3,5,9H2,(H,19,21)/b20-11+ |
| InChIKey | YHUXPHWTYOIVDE-RGVLZGJSSA-N |
| XLogP | 3.57 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|