C17H16N4OS — CID 162668600
N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 162668600) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 162668600 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(N/N=C3\CCCc4cccnc43)sc2c1 |
| InChI | InChI=1S/C17H16N4OS/c1-22-12-7-8-13-15(10-12)23-17(19-13)21-20-14-6-2-4-11-5-3-9-18-16(11)14/h3,5,7-10H,2,4,6H2,1H3,(H,19,21)/b20-14+ |
| InChIKey | JQADLKDPCNYXLX-XSFVSMFZSA-N |
| XLogP | 3.85 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|