C12H15N7O2S2 — CID 162671556
[(E)-1-[5-methyl-1-(4-sulfamoylphenyl)triazol-4-yl]ethylideneamino]thiourea (PubChem CID 162671556) has the molecular formula C12H15N7O2S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is [(E)-1-[5-methyl-1-(4-sulfamoylphenyl)triazol-4-yl]ethylideneamino]thiourea.
| Compound Name | [(E)-1-[5-methyl-1-(4-sulfamoylphenyl)triazol-4-yl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 162671556 |
| Molecular Formula | C12H15N7O2S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [(E)-1-[5-methyl-1-(4-sulfamoylphenyl)triazol-4-yl]ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(N)=S)c1nnn(-c2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C12H15N7O2S2/c1-7(15-17-12(13)22)11-8(2)19(18-16-11)9-3-5-10(6-4-9)23(14,20)21/h3-6H,1-2H3,(H3,13,17,22)(H2,14,20,21)/b15-7+ |
| InChIKey | ZSNUMVKUUMGBTC-VIZOYTHASA-N |
| XLogP | -0.22 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|