C11H11N7O2S2 — CID 155513169
4-[5-methyl-4-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)triazol-1-yl]benzenesulfonamide (PubChem CID 155513169) has the molecular formula C11H11N7O2S2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-[5-methyl-4-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)triazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-methyl-4-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155513169 |
| Molecular Formula | C11H11N7O2S2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 4-[5-methyl-4-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)triazol-1-yl]benzenesulfonamide |
| SMILES | Cc1c(-c2nc(=S)[nH][nH]2)nnn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H11N7O2S2/c1-6-9(10-13-11(21)16-15-10)14-17-18(6)7-2-4-8(5-3-7)22(12,19)20/h2-5H,1H3,(H2,12,19,20)(H2,13,15,16,21) |
| InChIKey | KSQJIDABRGZHPW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|