C16H13N7O2S2 — CID 155530326
4-[5-phenyl-4-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)triazol-1-yl]benzenesulfonamide (PubChem CID 155530326) has the molecular formula C16H13N7O2S2 and a molecular weight of 399.46 g/mol. Its IUPAC name is 4-[5-phenyl-4-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)triazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-phenyl-4-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155530326 |
| Molecular Formula | C16H13N7O2S2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-[5-phenyl-4-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)triazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nnc(-c3nc(=S)[nH][nH]3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H13N7O2S2/c17-27(24,25)12-8-6-11(7-9-12)23-14(10-4-2-1-3-5-10)13(19-22-23)15-18-16(26)21-20-15/h1-9H,(H2,17,24,25)(H2,18,20,21,26) |
| InChIKey | WOJVROUEEGRTEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|