C15H12ClN5O2S2 — CID 175679369
5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)triazole-4-carbothioamide (PubChem CID 175679369) has the molecular formula C15H12ClN5O2S2 and a molecular weight of 393.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)triazole-4-carbothioamide.
| Compound Name | 5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)triazole-4-carbothioamide |
|---|---|
| PubChem CID | 175679369 |
| Molecular Formula | C15H12ClN5O2S2 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(4-sulfamoylphenyl)triazole-4-carbothioamide |
| SMILES | NC(=S)c1nnn(-c2ccc(S(N)(=O)=O)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClN5O2S2/c16-10-3-1-9(2-4-10)14-13(15(17)24)19-20-21(14)11-5-7-12(8-6-11)25(18,22)23/h1-8H,(H2,17,24)(H2,18,22,23) |
| InChIKey | JTNROXFYLNNWTN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|