C18H21N5O — CID 162671763
4-[[6-(3-methyl-2H-indazol-5-yl)pyrazin-2-yl]amino]cyclohexan-1-ol (PubChem CID 162671763) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-[[6-(3-methyl-2H-indazol-5-yl)pyrazin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-(3-methyl-2H-indazol-5-yl)pyrazin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 162671763 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-[[6-(3-methyl-2H-indazol-5-yl)pyrazin-2-yl]amino]cyclohexan-1-ol |
| SMILES | Cc1[nH]nc2ccc(-c3cncc(NC4CCC(O)CC4)n3)cc12 |
| InChI | InChI=1S/C18H21N5O/c1-11-15-8-12(2-7-16(15)23-22-11)17-9-19-10-18(21-17)20-13-3-5-14(24)6-4-13/h2,7-10,13-14,24H,3-6H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | ICAXEGHQEDAHIQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |