C17H18N6 — CID 25167277
N-butyl-2-(1H-indazol-5-yl)imidazo[1,2-a]pyrimidin-3-amine (PubChem CID 25167277) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-butyl-2-(1H-indazol-5-yl)imidazo[1,2-a]pyrimidin-3-amine.
| Compound Name | N-butyl-2-(1H-indazol-5-yl)imidazo[1,2-a]pyrimidin-3-amine |
|---|---|
| PubChem CID | 25167277 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-butyl-2-(1H-indazol-5-yl)imidazo[1,2-a]pyrimidin-3-amine |
| SMILES | CCCCNc1c(-c2ccc3[nH]ncc3c2)nc2ncccn12 |
| InChI | InChI=1S/C17H18N6/c1-2-3-7-18-16-15(21-17-19-8-4-9-23(16)17)12-5-6-14-13(10-12)11-20-22-14/h4-6,8-11,18H,2-3,7H2,1H3,(H,20,22) |
| InChIKey | ZAOAKWGRHJIYTD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|