C21H22ClN3O2S — CID 162674184
(5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-[(1-methylpiperidin-3-yl)methylimino]-1,3-thiazolidin-4-one (PubChem CID 162674184) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-[(1-methylpiperidin-3-yl)methylimino]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-[(1-methylpiperidin-3-yl)methylimino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162674184 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (5Z)-5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-2-[(1-methylpiperidin-3-yl)methylimino]-1,3-thiazolidin-4-one |
| SMILES | CN1CCCC(C/N=C2\NC(=O)/C(=C/c3ccc(-c4cccc(Cl)c4)o3)S2)C1 |
| InChI | InChI=1S/C21H22ClN3O2S/c1-25-9-3-4-14(13-25)12-23-21-24-20(26)19(28-21)11-17-7-8-18(27-17)15-5-2-6-16(22)10-15/h2,5-8,10-11,14H,3-4,9,12-13H2,1H3,(H,23,24,26)/b19-11- |
| InChIKey | RGPZEVYDKJKFNL-ODLFYWEKSA-N |
| XLogP | 4.50 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|