C17H12FNO4S — CID 162674534
(E)-N-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 162674534) has the molecular formula C17H12FNO4S and a molecular weight of 345.35 g/mol. Its IUPAC name is (E)-N-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 162674534 |
| Molecular Formula | C17H12FNO4S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | (E)-N-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)Nc1ccc2c(c1)C=CS(=O)(=O)O2 |
| InChI | InChI=1S/C17H12FNO4S/c18-14-4-1-12(2-5-14)3-8-17(20)19-15-6-7-16-13(11-15)9-10-24(21,22)23-16/h1-11H,(H,19,20)/b8-3+ |
| InChIKey | YNEHIGLGCBHIHO-FPYGCLRLSA-N |
| XLogP | 3.17 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|