C32H26ClN5O3S — CID 162675069
4-chloro-N-[(E)-1-[4-[[2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]phenyl]ethylideneamino]benzamide (PubChem CID 162675069) has the molecular formula C32H26ClN5O3S and a molecular weight of 596.11 g/mol. Its IUPAC name is 4-chloro-N-[(E)-1-[4-[[2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]phenyl]ethylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-1-[4-[[2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 162675069 |
| Molecular Formula | C32H26ClN5O3S |
| Molecular Weight | 596.11 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | 4-chloro-N-[(E)-1-[4-[[2-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]phenyl]ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(Cl)cc1)c1ccc(NC(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H26ClN5O3S/c1-20-7-17-26(18-8-20)38-31(41)27-5-3-4-6-28(27)35-32(38)42-19-29(39)34-25-15-11-22(12-16-25)21(2)36-37-30(40)23-9-13-24(33)14-10-23/h3-18H,19H2,1-2H3,(H,34,39)(H,37,40)/b36-21+ |
| InChIKey | VODWLKBCNQBPPA-QLQYKETESA-N |
| XLogP | 6.23 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.11 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|