C28H22N4O6S2 — CID 162675595
[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-(thiophene-2-carbonylcarbamothioylamino)acetate (PubChem CID 162675595) has the molecular formula C28H22N4O6S2 and a molecular weight of 574.64 g/mol. Its IUPAC name is [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-(thiophene-2-carbonylcarbamothioylamino)acetate.
| Compound Name | [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-(thiophene-2-carbonylcarbamothioylamino)acetate |
|---|---|
| PubChem CID | 162675595 |
| Molecular Formula | C28H22N4O6S2 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-(thiophene-2-carbonylcarbamothioylamino)acetate |
| SMILES | CC[C@@]1(OC(=O)CNC(=S)NC(=O)c2cccs2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C28H22N4O6S2/c1-2-28(38-22(33)12-29-27(39)31-24(34)21-8-5-9-40-21)18-11-20-23-16(10-15-6-3-4-7-19(15)30-23)13-32(20)25(35)17(18)14-37-26(28)36/h3-11H,2,12-14H2,1H3,(H2,29,31,34,39)/t28-/m0/s1 |
| InChIKey | CNUWRMCLSHBGKU-NDEPHWFRSA-N |
| XLogP | 3.00 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|