C22H18N4O2 — CID 162675882
4-(5-benzamidoindol-1-yl)-N-methylpyridine-2-carboxamide (PubChem CID 162675882) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-(5-benzamidoindol-1-yl)-N-methylpyridine-2-carboxamide.
| Compound Name | 4-(5-benzamidoindol-1-yl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 162675882 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-(5-benzamidoindol-1-yl)-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(-n2ccc3cc(NC(=O)c4ccccc4)ccc32)ccn1 |
| InChI | InChI=1S/C22H18N4O2/c1-23-22(28)19-14-18(9-11-24-19)26-12-10-16-13-17(7-8-20(16)26)25-21(27)15-5-3-2-4-6-15/h2-14H,1H3,(H,23,28)(H,25,27) |
| InChIKey | IIEGUOUKRXNOPC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |