C25H25N3O2 — CID 58837417
N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide (PubChem CID 58837417) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide.
| Compound Name | N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide |
|---|---|
| PubChem CID | 58837417 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide |
| SMILES | CNC[C@@H](O)[C@H](c1ccccc1)n1ccc2cc(NC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C25H25N3O2/c1-26-17-23(29)24(18-8-4-2-5-9-18)28-15-14-20-16-21(12-13-22(20)28)27-25(30)19-10-6-3-7-11-19/h2-16,23-24,26,29H,17H2,1H3,(H,27,30)/t23-,24+/m1/s1 |
| InChIKey | ONRZGHKNSDFXSC-RPWUZVMVSA-N |
| XLogP | 4.06 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |