C18H21ClN2O — CID 68906230
(1R,2R)-1-indol-1-yl-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride (PubChem CID 68906230) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is (1R,2R)-1-indol-1-yl-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2R)-1-indol-1-yl-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 68906230 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (1R,2R)-1-indol-1-yl-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride |
| SMILES | CNC[C@@H](O)[C@@H](c1ccccc1)n1ccc2ccccc21.Cl |
| InChI | InChI=1S/C18H20N2O.ClH/c1-19-13-17(21)18(15-8-3-2-4-9-15)20-12-11-14-7-5-6-10-16(14)20;/h2-12,17-19,21H,13H2,1H3;1H/t17-,18-;/m1./s1 |
| InChIKey | LUIWHKVXZYFQLW-JAXOOIEVSA-N |
| XLogP | 3.23 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |