C18H19ClN2O — CID 11688248
1-(2-chlorophenyl)-1-indol-1-yl-3-(methylamino)propan-2-ol (PubChem CID 11688248) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-1-indol-1-yl-3-(methylamino)propan-2-ol.
| Compound Name | 1-(2-chlorophenyl)-1-indol-1-yl-3-(methylamino)propan-2-ol |
|---|---|
| PubChem CID | 11688248 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-(2-chlorophenyl)-1-indol-1-yl-3-(methylamino)propan-2-ol |
| SMILES | CNCC(O)C(c1ccccc1Cl)n1ccc2ccccc21 |
| InChI | InChI=1S/C18H19ClN2O/c1-20-12-17(22)18(14-7-3-4-8-15(14)19)21-11-10-13-6-2-5-9-16(13)21/h2-11,17-18,20,22H,12H2,1H3 |
| InChIKey | DGZJTKQIMNNTQO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |