About 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide
2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide (PubChem CID 141172289) has the molecular formula C25H24ClN3O2
and a molecular weight of 433.94 g/mol. Its IUPAC name is 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide |
| PubChem CID | 141172289 |
| Molecular Formula | C25H24ClN3O2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide |
| SMILES | CNC[C@@H](O)[C@H](c1ccccc1)n1ccc2cc(NC(=O)c3ccccc3Cl)ccc21 |
| InChI | InChI=1S/C25H24ClN3O2/c1-27-16-23(30)24(17-7-3-2-4-8-17)29-14-13-18-15-19(11-12-22(18)29)28-25(31)20-9-5-6-10-21(20)26/h2-15,23-24,27,30H,16H2,1H3,(H,28,31)/t23-,24+/m1/s1 |
| InChIKey | FFQDZMGJSQPLBG-RPWUZVMVSA-N |
| XLogP | 4.72 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide?
The IUPAC name of 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide (CID 141172289) is 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide.
What is the SMILES notation for 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide?
The canonical SMILES for 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide is CNC[C@@H](O)[C@H](c1ccccc1)n1ccc2cc(NC(=O)c3ccccc3Cl)ccc21.
What is the InChIKey of 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide?
The InChIKey is FFQDZMGJSQPLBG-RPWUZVMVSA-N. The full InChI is InChI=1S/C25H24ClN3O2/c1-27-16-23(30)24(17-7-3-2-4-8-17)29-14-13-18-15-19(11-12-22(18)29)28-25(31)20-9-5-6-10-21(20)26/h2-15,23-24,27,30H,16H2,1H3,(H,28,31)/t23-,24+/m1/s1.
What are the key properties of 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide?
2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide has a molecular weight of 433.94 g/mol, XLogP of 4.72, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[1-[(1S,2R)-2-hydroxy-3-(methylamino)-1-phenylpropyl]indol-5-yl]benzamide is sourced from PubChem (CID 141172289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).