C31H34N2O5S — CID 87717736
[(2S,3S)-3-[5-(cyclohexanecarbonylamino)indol-1-yl]-2-hydroxy-3-phenylpropyl] 4-methylbenzenesulfonate (PubChem CID 87717736) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is [(2S,3S)-3-[5-(cyclohexanecarbonylamino)indol-1-yl]-2-hydroxy-3-phenylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-3-[5-(cyclohexanecarbonylamino)indol-1-yl]-2-hydroxy-3-phenylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87717736 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [(2S,3S)-3-[5-(cyclohexanecarbonylamino)indol-1-yl]-2-hydroxy-3-phenylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)[C@H](c2ccccc2)n2ccc3cc(NC(=O)C4CCCCC4)ccc32)cc1 |
| InChI | InChI=1S/C31H34N2O5S/c1-22-12-15-27(16-13-22)39(36,37)38-21-29(34)30(23-8-4-2-5-9-23)33-19-18-25-20-26(14-17-28(25)33)32-31(35)24-10-6-3-7-11-24/h2,4-5,8-9,12-20,24,29-30,34H,3,6-7,10-11,21H2,1H3,(H,32,35)/t29-,30+/m1/s1 |
| InChIKey | UJZICXHJOZMGQX-IHLOFXLRSA-N |
| XLogP | 5.82 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|