C32H27NO4S — CID 87717526
[(2R,3S)-2-hydroxy-3-phenyl-3-[5-(2-phenylethynyl)indol-1-yl]propyl] 4-methylbenzenesulfonate (PubChem CID 87717526) has the molecular formula C32H27NO4S and a molecular weight of 521.64 g/mol. Its IUPAC name is [(2R,3S)-2-hydroxy-3-phenyl-3-[5-(2-phenylethynyl)indol-1-yl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-2-hydroxy-3-phenyl-3-[5-(2-phenylethynyl)indol-1-yl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87717526 |
| Molecular Formula | C32H27NO4S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | [(2R,3S)-2-hydroxy-3-phenyl-3-[5-(2-phenylethynyl)indol-1-yl]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)[C@H](c2ccccc2)n2ccc3cc(C#Cc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C32H27NO4S/c1-24-12-17-29(18-13-24)38(35,36)37-23-31(34)32(27-10-6-3-7-11-27)33-21-20-28-22-26(16-19-30(28)33)15-14-25-8-4-2-5-9-25/h2-13,16-22,31-32,34H,23H2,1H3/t31-,32-/m0/s1 |
| InChIKey | RWHPDKZKGFQJTE-ACHIHNKUSA-N |
| XLogP | 5.71 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|