C24H22ClNO4S — CID 141126968
[3-(5-chloroindol-1-yl)-2-hydroxy-3-phenylpropyl] 4-methylbenzenesulfonate (PubChem CID 141126968) has the molecular formula C24H22ClNO4S and a molecular weight of 455.96 g/mol. Its IUPAC name is [3-(5-chloroindol-1-yl)-2-hydroxy-3-phenylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [3-(5-chloroindol-1-yl)-2-hydroxy-3-phenylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 141126968 |
| Molecular Formula | C24H22ClNO4S |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [3-(5-chloroindol-1-yl)-2-hydroxy-3-phenylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)C(c2ccccc2)n2ccc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C24H22ClNO4S/c1-17-7-10-21(11-8-17)31(28,29)30-16-23(27)24(18-5-3-2-4-6-18)26-14-13-19-15-20(25)9-12-22(19)26/h2-15,23-24,27H,16H2,1H3 |
| InChIKey | IVKMHHSPKHXSQN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|