C30H27NO5S — CID 87717316
[2-hydroxy-3-(5-phenoxyindol-1-yl)-3-phenylpropyl] 4-methylbenzenesulfonate (PubChem CID 87717316) has the molecular formula C30H27NO5S and a molecular weight of 513.62 g/mol. Its IUPAC name is [2-hydroxy-3-(5-phenoxyindol-1-yl)-3-phenylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [2-hydroxy-3-(5-phenoxyindol-1-yl)-3-phenylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87717316 |
| Molecular Formula | C30H27NO5S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | [2-hydroxy-3-(5-phenoxyindol-1-yl)-3-phenylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)C(c2ccccc2)n2ccc3cc(Oc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C30H27NO5S/c1-22-12-15-27(16-13-22)37(33,34)35-21-29(32)30(23-8-4-2-5-9-23)31-19-18-24-20-26(14-17-28(24)31)36-25-10-6-3-7-11-25/h2-20,29-30,32H,21H2,1H3 |
| InChIKey | CZAMWOSUJASVTP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|