C30H27NO4S — CID 87717651
[2-hydroxy-3-phenyl-3-(7-phenylindol-1-yl)propyl] 4-methylbenzenesulfonate (PubChem CID 87717651) has the molecular formula C30H27NO4S and a molecular weight of 497.62 g/mol. Its IUPAC name is [2-hydroxy-3-phenyl-3-(7-phenylindol-1-yl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [2-hydroxy-3-phenyl-3-(7-phenylindol-1-yl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87717651 |
| Molecular Formula | C30H27NO4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [2-hydroxy-3-phenyl-3-(7-phenylindol-1-yl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)C(c2ccccc2)n2ccc3cccc(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C30H27NO4S/c1-22-15-17-26(18-16-22)36(33,34)35-21-28(32)30(24-11-6-3-7-12-24)31-20-19-25-13-8-14-27(29(25)31)23-9-4-2-5-10-23/h2-20,28,30,32H,21H2,1H3 |
| InChIKey | GXRBDILZAKFOLL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|