C25H24FNO4S — CID 87618398
[(2S,3S)-3-(3-fluorophenyl)-2-hydroxy-3-(5-methylindol-1-yl)propyl] 4-methylbenzenesulfonate (PubChem CID 87618398) has the molecular formula C25H24FNO4S and a molecular weight of 453.54 g/mol. Its IUPAC name is [(2S,3S)-3-(3-fluorophenyl)-2-hydroxy-3-(5-methylindol-1-yl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-3-(3-fluorophenyl)-2-hydroxy-3-(5-methylindol-1-yl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87618398 |
| Molecular Formula | C25H24FNO4S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | [(2S,3S)-3-(3-fluorophenyl)-2-hydroxy-3-(5-methylindol-1-yl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)[C@H](c2cccc(F)c2)n2ccc3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C25H24FNO4S/c1-17-6-9-22(10-7-17)32(29,30)31-16-24(28)25(20-4-3-5-21(26)15-20)27-13-12-19-14-18(2)8-11-23(19)27/h3-15,24-25,28H,16H2,1-2H3/t24-,25+/m1/s1 |
| InChIKey | MIOPESKBJKCRJT-RPBOFIJWSA-N |
| XLogP | 4.75 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|