C24H23NO4S — CID 141126955
[(2R,3R)-2-hydroxy-3-indol-1-yl-3-phenylpropyl] 4-methylbenzenesulfonate (PubChem CID 141126955) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is [(2R,3R)-2-hydroxy-3-indol-1-yl-3-phenylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R)-2-hydroxy-3-indol-1-yl-3-phenylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 141126955 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [(2R,3R)-2-hydroxy-3-indol-1-yl-3-phenylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)[C@@H](c2ccccc2)n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C24H23NO4S/c1-18-11-13-21(14-12-18)30(27,28)29-17-23(26)24(20-8-3-2-4-9-20)25-16-15-19-7-5-6-10-22(19)25/h2-16,23-24,26H,17H2,1H3/t23-,24+/m0/s1 |
| InChIKey | BOJYZDUUOKEFKI-BJKOFHAPSA-N |
| XLogP | 4.31 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|