C33H45N3O2 — CID 162677086
N-tert-butyl-N-[2-(decylamino)-2-oxoethyl]-3-(naphthalen-1-ylamino)benzamide (PubChem CID 162677086) has the molecular formula C33H45N3O2 and a molecular weight of 515.74 g/mol. Its IUPAC name is N-tert-butyl-N-[2-(decylamino)-2-oxoethyl]-3-(naphthalen-1-ylamino)benzamide.
| Compound Name | N-tert-butyl-N-[2-(decylamino)-2-oxoethyl]-3-(naphthalen-1-ylamino)benzamide |
|---|---|
| PubChem CID | 162677086 |
| Molecular Formula | C33H45N3O2 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.35 |
| IUPAC Name | N-tert-butyl-N-[2-(decylamino)-2-oxoethyl]-3-(naphthalen-1-ylamino)benzamide |
| SMILES | CCCCCCCCCCNC(=O)CN(C(=O)c1cccc(Nc2cccc3ccccc23)c1)C(C)(C)C |
| InChI | InChI=1S/C33H45N3O2/c1-5-6-7-8-9-10-11-14-23-34-31(37)25-36(33(2,3)4)32(38)27-19-15-20-28(24-27)35-30-22-16-18-26-17-12-13-21-29(26)30/h12-13,15-22,24,35H,5-11,14,23,25H2,1-4H3,(H,34,37) |
| InChIKey | IWAQXVIDBRDNAB-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|