C31H44FN3O2 — CID 162655476
N-cyclohexyl-N-[2-(decylamino)-2-oxoethyl]-3-(4-fluoroanilino)benzamide (PubChem CID 162655476) has the molecular formula C31H44FN3O2 and a molecular weight of 509.71 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-(decylamino)-2-oxoethyl]-3-(4-fluoroanilino)benzamide.
| Compound Name | N-cyclohexyl-N-[2-(decylamino)-2-oxoethyl]-3-(4-fluoroanilino)benzamide |
|---|---|
| PubChem CID | 162655476 |
| Molecular Formula | C31H44FN3O2 |
| Molecular Weight | 509.71 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | N-cyclohexyl-N-[2-(decylamino)-2-oxoethyl]-3-(4-fluoroanilino)benzamide |
| SMILES | CCCCCCCCCCNC(=O)CN(C(=O)c1cccc(Nc2ccc(F)cc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C31H44FN3O2/c1-2-3-4-5-6-7-8-12-22-33-30(36)24-35(29-16-10-9-11-17-29)31(37)25-14-13-15-28(23-25)34-27-20-18-26(32)19-21-27/h13-15,18-21,23,29,34H,2-12,16-17,22,24H2,1H3,(H,33,36) |
| InChIKey | NVTOBBHQSADGAO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.71 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|