C15H17ClF3NO2 — CID 162679473
2-chloro-1-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]ethanone (PubChem CID 162679473) has the molecular formula C15H17ClF3NO2 and a molecular weight of 335.75 g/mol. Its IUPAC name is 2-chloro-1-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 162679473 |
| Molecular Formula | C15H17ClF3NO2 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-chloro-1-[3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-1-yl]ethanone |
| SMILES | O=C(CCl)N1CCCC(COc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H17ClF3NO2/c16-8-14(21)20-7-1-2-11(9-20)10-22-13-5-3-12(4-6-13)15(17,18)19/h3-6,11H,1-2,7-10H2 |
| InChIKey | ZHOUMOBVVYTKPO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|