C22H31ClN4O5 — CID 162680100
benzyl N-[(2S)-1-[2-(2-chloroacetyl)-2-[(2-oxopiperidin-3-yl)methyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 162680100) has the molecular formula C22H31ClN4O5 and a molecular weight of 466.97 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-(2-chloroacetyl)-2-[(2-oxopiperidin-3-yl)methyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-(2-chloroacetyl)-2-[(2-oxopiperidin-3-yl)methyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 162680100 |
| Molecular Formula | C22H31ClN4O5 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | benzyl N-[(2S)-1-[2-(2-chloroacetyl)-2-[(2-oxopiperidin-3-yl)methyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NN(CC1CCCNC1=O)C(=O)CCl |
| InChI | InChI=1S/C22H31ClN4O5/c1-15(2)11-18(25-22(31)32-14-16-7-4-3-5-8-16)21(30)26-27(19(28)12-23)13-17-9-6-10-24-20(17)29/h3-5,7-8,15,17-18H,6,9-14H2,1-2H3,(H,24,29)(H,25,31)(H,26,30)/t17?,18-/m0/s1 |
| InChIKey | SUJHQSHWRKZNKS-ZVAWYAOSSA-N |
| XLogP | 1.95 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|