C19H37N3O6 — CID 162681486
6-[carboxymethyl-[2-[2-[carboxymethyl(propyl)amino]ethyl-ethylamino]ethyl]amino]hexanoic acid (PubChem CID 162681486) has the molecular formula C19H37N3O6 and a molecular weight of 403.52 g/mol. Its IUPAC name is 6-[carboxymethyl-[2-[2-[carboxymethyl(propyl)amino]ethyl-ethylamino]ethyl]amino]hexanoic acid.
| Compound Name | 6-[carboxymethyl-[2-[2-[carboxymethyl(propyl)amino]ethyl-ethylamino]ethyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 162681486 |
| Molecular Formula | C19H37N3O6 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 6-[carboxymethyl-[2-[2-[carboxymethyl(propyl)amino]ethyl-ethylamino]ethyl]amino]hexanoic acid |
| SMILES | CCCN(CCN(CC)CCN(CCCCCC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C19H37N3O6/c1-3-9-21(15-18(25)26)13-11-20(4-2)12-14-22(16-19(27)28)10-7-5-6-8-17(23)24/h3-16H2,1-2H3,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | JYYVRCVUJSHJGE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|