C8H15NO — CID 162681543
2-(2-methylpropyl)-5,6-dihydro-4H-1,3-oxazine (PubChem CID 162681543) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 2-(2-methylpropyl)-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | 2-(2-methylpropyl)-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 162681543 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2-(2-methylpropyl)-5,6-dihydro-4H-1,3-oxazine |
| SMILES | CC(C)CC1=NCCCO1 |
| InChI | InChI=1S/C8H15NO/c1-7(2)6-8-9-4-3-5-10-8/h7H,3-6H2,1-2H3 |
| InChIKey | BLMLJIPIRKMSPL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |