C5H9FN2O — CID 169105660
5,6-dihydro-4H-1,3-oxazin-2-yl(fluoro)methanamine (PubChem CID 169105660) has the molecular formula C5H9FN2O and a molecular weight of 132.14 g/mol. Its IUPAC name is 5,6-dihydro-4H-1,3-oxazin-2-yl(fluoro)methanamine.
| Compound Name | 5,6-dihydro-4H-1,3-oxazin-2-yl(fluoro)methanamine |
|---|---|
| PubChem CID | 169105660 |
| Molecular Formula | C5H9FN2O |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 5,6-dihydro-4H-1,3-oxazin-2-yl(fluoro)methanamine |
| SMILES | NC(F)C1=NCCCO1 |
| InChI | InChI=1S/C5H9FN2O/c6-4(7)5-8-2-1-3-9-5/h4H,1-3,7H2 |
| InChIKey | HVDVTWGAJROUQH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|