C19H16BrFN4O — CID 162683498
7-(bromomethyl)-8-fluoro-5-methyl-3-[(6-methyl-2-pyridinyl)methyl]pyridazino[4,5-b]indol-4-one (PubChem CID 162683498) has the molecular formula C19H16BrFN4O and a molecular weight of 415.27 g/mol. Its IUPAC name is 7-(bromomethyl)-8-fluoro-5-methyl-3-[(6-methyl-2-pyridinyl)methyl]pyridazino[4,5-b]indol-4-one.
| Compound Name | 7-(bromomethyl)-8-fluoro-5-methyl-3-[(6-methyl-2-pyridinyl)methyl]pyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 162683498 |
| Molecular Formula | C19H16BrFN4O |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 7-(bromomethyl)-8-fluoro-5-methyl-3-[(6-methyl-2-pyridinyl)methyl]pyridazino[4,5-b]indol-4-one |
| SMILES | Cc1cccc(Cn2ncc3c4cc(F)c(CBr)cc4n(C)c3c2=O)n1 |
| InChI | InChI=1S/C19H16BrFN4O/c1-11-4-3-5-13(23-11)10-25-19(26)18-15(9-22-25)14-7-16(21)12(8-20)6-17(14)24(18)2/h3-7,9H,8,10H2,1-2H3 |
| InChIKey | PUDZHGGOHOPANX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|