C26H22N6O — CID 170353334
3-(1H-indazol-4-ylmethyl)-5-methyl-7-[(6-methyl-2-pyridinyl)methyl]pyridazino[4,5-b]indol-4-one (PubChem CID 170353334) has the molecular formula C26H22N6O and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-(1H-indazol-4-ylmethyl)-5-methyl-7-[(6-methyl-2-pyridinyl)methyl]pyridazino[4,5-b]indol-4-one.
| Compound Name | 3-(1H-indazol-4-ylmethyl)-5-methyl-7-[(6-methyl-2-pyridinyl)methyl]pyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 170353334 |
| Molecular Formula | C26H22N6O |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 3-(1H-indazol-4-ylmethyl)-5-methyl-7-[(6-methyl-2-pyridinyl)methyl]pyridazino[4,5-b]indol-4-one |
| SMILES | Cc1cccc(Cc2ccc3c4cnn(Cc5cccc6[nH]ncc56)c(=O)c4n(C)c3c2)n1 |
| InChI | InChI=1S/C26H22N6O/c1-16-5-3-7-19(29-16)11-17-9-10-20-22-14-28-32(26(33)25(22)31(2)24(20)12-17)15-18-6-4-8-23-21(18)13-27-30-23/h3-10,12-14H,11,15H2,1-2H3,(H,27,30) |
| InChIKey | MXSSCISAKYTLEQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|