C20H15N7O3S — CID 163575847
3-[[10-(1H-indazol-4-ylmethyl)-7-methyl-9-oxo-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-4-yl]methylamino]cyclopropane-1,2-dione (PubChem CID 163575847) has the molecular formula C20H15N7O3S and a molecular weight of 433.45 g/mol. Its IUPAC name is 3-[[10-(1H-indazol-4-ylmethyl)-7-methyl-9-oxo-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-4-yl]methylamino]cyclopropane-1,2-dione.
| Compound Name | 3-[[10-(1H-indazol-4-ylmethyl)-7-methyl-9-oxo-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-4-yl]methylamino]cyclopropane-1,2-dione |
|---|---|
| PubChem CID | 163575847 |
| Molecular Formula | C20H15N7O3S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-[[10-(1H-indazol-4-ylmethyl)-7-methyl-9-oxo-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-4-yl]methylamino]cyclopropane-1,2-dione |
| SMILES | Cn1c2nc(CNC3C(=O)C3=O)sc2c2cnn(Cc3cccc4[nH]ncc34)c(=O)c21 |
| InChI | InChI=1S/C20H15N7O3S/c1-26-15-11(18-19(26)24-13(31-18)7-21-14-16(28)17(14)29)6-23-27(20(15)30)8-9-3-2-4-12-10(9)5-22-25-12/h2-6,14,21H,7-8H2,1H3,(H,22,25) |
| InChIKey | GDJZFMBESXOHHR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|