C20H16N8OS — CID 162683544
10-(1H-indazol-4-ylmethyl)-7-methyl-4-(1H-pyrazol-5-ylmethyl)-5-thia-3,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one (PubChem CID 162683544) has the molecular formula C20H16N8OS and a molecular weight of 416.47 g/mol. Its IUPAC name is 10-(1H-indazol-4-ylmethyl)-7-methyl-4-(1H-pyrazol-5-ylmethyl)-5-thia-3,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one.
| Compound Name | 10-(1H-indazol-4-ylmethyl)-7-methyl-4-(1H-pyrazol-5-ylmethyl)-5-thia-3,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one |
|---|---|
| PubChem CID | 162683544 |
| Molecular Formula | C20H16N8OS |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 10-(1H-indazol-4-ylmethyl)-7-methyl-4-(1H-pyrazol-5-ylmethyl)-5-thia-3,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,11-tetraen-9-one |
| SMILES | Cn1c2sc(Cc3ccn[nH]3)nc2c2cnn(Cc3cccc4[nH]ncc34)c(=O)c21 |
| InChI | InChI=1S/C20H16N8OS/c1-27-18-14(17-20(27)30-16(24-17)7-12-5-6-21-25-12)9-23-28(19(18)29)10-11-3-2-4-15-13(11)8-22-26-15/h2-6,8-9H,7,10H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | GNCWQSLGMDUWMA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |