C25H19N7OS — CID 167533330
4-(1H-indazol-4-ylmethyl)-10-(1H-isoindol-4-ylmethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 167533330) has the molecular formula C25H19N7OS and a molecular weight of 465.54 g/mol. Its IUPAC name is 4-(1H-indazol-4-ylmethyl)-10-(1H-isoindol-4-ylmethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 4-(1H-indazol-4-ylmethyl)-10-(1H-isoindol-4-ylmethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 167533330 |
| Molecular Formula | C25H19N7OS |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 4-(1H-indazol-4-ylmethyl)-10-(1H-isoindol-4-ylmethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cn1c2nc(Cc3cccc4[nH]ncc34)sc2c2cnn(Cc3cccc4c3C=NC4)c(=O)c21 |
| InChI | InChI=1S/C25H19N7OS/c1-31-22-19(12-28-32(25(22)33)13-16-6-2-5-15-9-26-10-17(15)16)23-24(31)29-21(34-23)8-14-4-3-7-20-18(14)11-27-30-20/h2-7,10-12H,8-9,13H2,1H3,(H,27,30) |
| InChIKey | SAJDOFHNIDOWJR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |